C31H55BrO2 — CID 172545244
(17-bromo-4,6,8,10,12,14-hexamethylheptadecoxy)methoxymethylbenzene (PubChem CID 172545244) has the molecular formula C31H55BrO2 and a molecular weight of 539.68 g/mol. Its IUPAC name is (17-bromo-4,6,8,10,12,14-hexamethylheptadecoxy)methoxymethylbenzene.
| Compound Name | (17-bromo-4,6,8,10,12,14-hexamethylheptadecoxy)methoxymethylbenzene |
|---|---|
| PubChem CID | 172545244 |
| Molecular Formula | C31H55BrO2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | (17-bromo-4,6,8,10,12,14-hexamethylheptadecoxy)methoxymethylbenzene |
| SMILES | CC(CCCBr)CC(C)CC(C)CC(C)CC(C)CC(C)CCCOCOCc1ccccc1 |
| InChI | InChI=1S/C31H55BrO2/c1-25(12-10-16-32)18-27(3)20-29(5)22-30(6)21-28(4)19-26(2)13-11-17-33-24-34-23-31-14-8-7-9-15-31/h7-9,14-15,25-30H,10-13,16-24H2,1-6H3 |
| InChIKey | DLTBJYYQTGCEQJ-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|