C68H120Br2O3 — CID 176549085
[20-bromo-1-(20-bromo-5,7,9,11,13,15,17-heptamethyl-1-phenylmethoxyicosoxy)-5,7,9,11,13,15,17-heptamethylicosoxy]methylbenzene (PubChem CID 176549085) has the molecular formula C68H120Br2O3 and a molecular weight of 1145.51 g/mol. Its IUPAC name is [20-bromo-1-(20-bromo-5,7,9,11,13,15,17-heptamethyl-1-phenylmethoxyicosoxy)-5,7,9,11,13,15,17-heptamethylicosoxy]methylbenzene.
| Compound Name | [20-bromo-1-(20-bromo-5,7,9,11,13,15,17-heptamethyl-1-phenylmethoxyicosoxy)-5,7,9,11,13,15,17-heptamethylicosoxy]methylbenzene |
|---|---|
| PubChem CID | 176549085 |
| Molecular Formula | C68H120Br2O3 |
| Molecular Weight | 1145.51 g/mol |
| Exact Mass | 1142.76 |
| IUPAC Name | [20-bromo-1-(20-bromo-5,7,9,11,13,15,17-heptamethyl-1-phenylmethoxyicosoxy)-5,7,9,11,13,15,17-heptamethylicosoxy]methylbenzene |
| SMILES | CC(CCCBr)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CCCC(OCc1ccccc1)OC(CCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CCCBr)OCc1ccccc1 |
| InChI | InChI=1S/C68H120Br2O3/c1-51(37-55(5)41-59(9)45-63(13)47-61(11)43-57(7)39-53(3)27-23-35-69)25-21-33-67(71-49-65-29-17-15-18-30-65)73-68(72-50-66-31-19-16-20-32-66)34-22-26-52(2)38-56(6)42-60(10)46-64(14)48-62(12)44-58(8)40-54(4)28-24-36-70/h15-20,29-32,51-64,67-68H,21-28,33-50H2,1-14H3 |
| InChIKey | PVYCZJHEEBBQOX-UHFFFAOYSA-N |
| XLogP | 22.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1145.51 |
| LogP ≤ 5 | 22.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|