C42H84Br2O3 — CID 176549199
11-bromo-1-(11-bromo-1-hexoxy-5,7,9-trimethyldodecoxy)-1-hexoxy-5,7,9-trimethyldodecane (PubChem CID 176549199) has the molecular formula C42H84Br2O3 and a molecular weight of 796.94 g/mol. Its IUPAC name is 11-bromo-1-(11-bromo-1-hexoxy-5,7,9-trimethyldodecoxy)-1-hexoxy-5,7,9-trimethyldodecane.
| Compound Name | 11-bromo-1-(11-bromo-1-hexoxy-5,7,9-trimethyldodecoxy)-1-hexoxy-5,7,9-trimethyldodecane |
|---|---|
| PubChem CID | 176549199 |
| Molecular Formula | C42H84Br2O3 |
| Molecular Weight | 796.94 g/mol |
| Exact Mass | 794.48 |
| IUPAC Name | 11-bromo-1-(11-bromo-1-hexoxy-5,7,9-trimethyldodecoxy)-1-hexoxy-5,7,9-trimethyldodecane |
| SMILES | CCCCCCOC(CCCC(C)CC(C)CC(C)CC(C)Br)OC(CCCC(C)CC(C)CC(C)CC(C)Br)OCCCCCC |
| InChI | InChI=1S/C42H84Br2O3/c1-11-13-15-17-25-45-41(23-19-21-33(3)27-35(5)29-37(7)31-39(9)43)47-42(46-26-18-16-14-12-2)24-20-22-34(4)28-36(6)30-38(8)32-40(10)44/h33-42H,11-32H2,1-10H3 |
| InChIKey | PXGDUEXKAPZBJI-UHFFFAOYSA-N |
| XLogP | 14.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.94 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|