C60H122O5 — CID 176549204
18-hexoxy-18-(1-hexoxy-17-hydroxy-5,7,9,11,13,15-hexamethyloctadecoxy)-4,6,8,10,12,14-hexamethyloctadecan-2-ol (PubChem CID 176549204) has the molecular formula C60H122O5 and a molecular weight of 923.63 g/mol. Its IUPAC name is 18-hexoxy-18-(1-hexoxy-17-hydroxy-5,7,9,11,13,15-hexamethyloctadecoxy)-4,6,8,10,12,14-hexamethyloctadecan-2-ol.
| Compound Name | 18-hexoxy-18-(1-hexoxy-17-hydroxy-5,7,9,11,13,15-hexamethyloctadecoxy)-4,6,8,10,12,14-hexamethyloctadecan-2-ol |
|---|---|
| PubChem CID | 176549204 |
| Molecular Formula | C60H122O5 |
| Molecular Weight | 923.63 g/mol |
| Exact Mass | 922.93 |
| IUPAC Name | 18-hexoxy-18-(1-hexoxy-17-hydroxy-5,7,9,11,13,15-hexamethyloctadecoxy)-4,6,8,10,12,14-hexamethyloctadecan-2-ol |
| SMILES | CCCCCCOC(CCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)O)OC(CCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)O)OCCCCCC |
| InChI | InChI=1S/C60H122O5/c1-17-19-21-23-31-63-59(29-25-27-45(3)33-47(5)35-49(7)37-51(9)39-53(11)41-55(13)43-57(15)61)65-60(64-32-24-22-20-18-2)30-26-28-46(4)34-48(6)36-50(8)38-52(10)40-54(12)42-56(14)44-58(16)62/h45-62H,17-44H2,1-16H3 |
| InChIKey | MFWMNXBVCLOHTH-UHFFFAOYSA-N |
| XLogP | 18.27 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.63 |
| LogP ≤ 5 | 18.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|