C60H120I2O3 — CID 176549135
15-iodo-1-(15-iodo-5,7,9,11,13-pentamethyl-1-nonoxyhexadecoxy)-5,7,9,11,13-pentamethyl-1-nonoxyhexadecane (PubChem CID 176549135) has the molecular formula C60H120I2O3 and a molecular weight of 1143.42 g/mol. Its IUPAC name is 15-iodo-1-(15-iodo-5,7,9,11,13-pentamethyl-1-nonoxyhexadecoxy)-5,7,9,11,13-pentamethyl-1-nonoxyhexadecane.
| Compound Name | 15-iodo-1-(15-iodo-5,7,9,11,13-pentamethyl-1-nonoxyhexadecoxy)-5,7,9,11,13-pentamethyl-1-nonoxyhexadecane |
|---|---|
| PubChem CID | 176549135 |
| Molecular Formula | C60H120I2O3 |
| Molecular Weight | 1143.42 g/mol |
| Exact Mass | 1142.73 |
| IUPAC Name | 15-iodo-1-(15-iodo-5,7,9,11,13-pentamethyl-1-nonoxyhexadecoxy)-5,7,9,11,13-pentamethyl-1-nonoxyhexadecane |
| SMILES | CCCCCCCCCOC(CCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)I)OC(CCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)I)OCCCCCCCCC |
| InChI | InChI=1S/C60H120I2O3/c1-15-17-19-21-23-25-27-35-63-59(33-29-31-47(3)37-49(5)39-51(7)41-53(9)43-55(11)45-57(13)61)65-60(64-36-28-26-24-22-20-18-16-2)34-30-32-48(4)38-50(6)40-52(8)42-54(10)44-56(12)46-58(14)62/h47-60H,15-46H2,1-14H3 |
| InChIKey | PLYWNINZWVOLOJ-UHFFFAOYSA-N |
| XLogP | 21.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1143.42 |
| LogP ≤ 5 | 21.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|