C38H76I2O3 — CID 176549006
6-iodo-1-[1-[1-(6-iododecoxy)-5-methyloctoxy]-5-methyloctoxy]decane (PubChem CID 176549006) has the molecular formula C38H76I2O3 and a molecular weight of 834.83 g/mol. Its IUPAC name is 6-iodo-1-[1-[1-(6-iododecoxy)-5-methyloctoxy]-5-methyloctoxy]decane.
| Compound Name | 6-iodo-1-[1-[1-(6-iododecoxy)-5-methyloctoxy]-5-methyloctoxy]decane |
|---|---|
| PubChem CID | 176549006 |
| Molecular Formula | C38H76I2O3 |
| Molecular Weight | 834.83 g/mol |
| Exact Mass | 834.39 |
| IUPAC Name | 6-iodo-1-[1-[1-(6-iododecoxy)-5-methyloctoxy]-5-methyloctoxy]decane |
| SMILES | CCCCC(I)CCCCCOC(CCCC(C)CCC)OC(CCCC(C)CCC)OCCCCCC(I)CCCC |
| InChI | InChI=1S/C38H76I2O3/c1-7-11-25-35(39)27-15-13-17-31-41-37(29-19-23-33(5)21-9-3)43-38(30-20-24-34(6)22-10-4)42-32-18-14-16-28-36(40)26-12-8-2/h33-38H,7-32H2,1-6H3 |
| InChIKey | FMMVIPXDIBDEGG-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.83 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|