C68H138O5 — CID 176549186
20-heptoxy-20-(1-heptoxy-19-hydroxy-5,7,9,11,13,15,17-heptamethylicosoxy)-4,6,8,10,12,14,16-heptamethylicosan-2-ol (PubChem CID 176549186) has the molecular formula C68H138O5 and a molecular weight of 1035.85 g/mol. Its IUPAC name is 20-heptoxy-20-(1-heptoxy-19-hydroxy-5,7,9,11,13,15,17-heptamethylicosoxy)-4,6,8,10,12,14,16-heptamethylicosan-2-ol.
| Compound Name | 20-heptoxy-20-(1-heptoxy-19-hydroxy-5,7,9,11,13,15,17-heptamethylicosoxy)-4,6,8,10,12,14,16-heptamethylicosan-2-ol |
|---|---|
| PubChem CID | 176549186 |
| Molecular Formula | C68H138O5 |
| Molecular Weight | 1035.85 g/mol |
| Exact Mass | 1035.05 |
| IUPAC Name | 20-heptoxy-20-(1-heptoxy-19-hydroxy-5,7,9,11,13,15,17-heptamethylicosoxy)-4,6,8,10,12,14,16-heptamethylicosan-2-ol |
| SMILES | CCCCCCCOC(CCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)O)OC(CCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)O)OCCCCCCC |
| InChI | InChI=1S/C68H138O5/c1-19-21-23-25-27-35-71-67(33-29-31-51(3)37-53(5)39-55(7)41-57(9)43-59(11)45-61(13)47-63(15)49-65(17)69)73-68(72-36-28-26-24-22-20-2)34-30-32-52(4)38-54(6)40-56(8)42-58(10)44-60(12)46-62(14)48-64(16)50-66(18)70/h51-70H,19-50H2,1-18H3 |
| InChIKey | UIJFDPAYKGIMBQ-UHFFFAOYSA-N |
| XLogP | 21.10 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.85 |
| LogP ≤ 5 | 21.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|