C32H66O3 — CID 172545315
4,6,8,10,12,14-hexamethyl-17-(octoxymethoxy)heptadecan-2-ol (PubChem CID 172545315) has the molecular formula C32H66O3 and a molecular weight of 498.88 g/mol. Its IUPAC name is 4,6,8,10,12,14-hexamethyl-17-(octoxymethoxy)heptadecan-2-ol.
| Compound Name | 4,6,8,10,12,14-hexamethyl-17-(octoxymethoxy)heptadecan-2-ol |
|---|---|
| PubChem CID | 172545315 |
| Molecular Formula | C32H66O3 |
| Molecular Weight | 498.88 g/mol |
| Exact Mass | 498.50 |
| IUPAC Name | 4,6,8,10,12,14-hexamethyl-17-(octoxymethoxy)heptadecan-2-ol |
| SMILES | CCCCCCCCOCOCCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)O |
| InChI | InChI=1S/C32H66O3/c1-9-10-11-12-13-14-17-34-25-35-18-15-16-26(2)19-27(3)20-28(4)21-29(5)22-30(6)23-31(7)24-32(8)33/h26-33H,9-25H2,1-8H3 |
| InChIKey | WXKFTUBAFXWZQI-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.88 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|