C15H31ClO2 — CID 172545057
8-chloro-4,6-dimethyl-1-(propoxymethoxy)nonane (PubChem CID 172545057) has the molecular formula C15H31ClO2 and a molecular weight of 278.86 g/mol. Its IUPAC name is 8-chloro-4,6-dimethyl-1-(propoxymethoxy)nonane.
| Compound Name | 8-chloro-4,6-dimethyl-1-(propoxymethoxy)nonane |
|---|---|
| PubChem CID | 172545057 |
| Molecular Formula | C15H31ClO2 |
| Molecular Weight | 278.86 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 8-chloro-4,6-dimethyl-1-(propoxymethoxy)nonane |
| SMILES | CCCOCOCCCC(C)CC(C)CC(C)Cl |
| InChI | InChI=1S/C15H31ClO2/c1-5-8-17-12-18-9-6-7-13(2)10-14(3)11-15(4)16/h13-15H,5-12H2,1-4H3 |
| InChIKey | XJYRPUJXYZLOLM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.86 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|