C16H33ClO2 — CID 172545343
1-(butoxymethoxy)-8-chloro-4,6-dimethylnonane (PubChem CID 172545343) has the molecular formula C16H33ClO2 and a molecular weight of 292.89 g/mol. Its IUPAC name is 1-(butoxymethoxy)-8-chloro-4,6-dimethylnonane.
| Compound Name | 1-(butoxymethoxy)-8-chloro-4,6-dimethylnonane |
|---|---|
| PubChem CID | 172545343 |
| Molecular Formula | C16H33ClO2 |
| Molecular Weight | 292.89 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-(butoxymethoxy)-8-chloro-4,6-dimethylnonane |
| SMILES | CCCCOCOCCCC(C)CC(C)CC(C)Cl |
| InChI | InChI=1S/C16H33ClO2/c1-5-6-9-18-13-19-10-7-8-14(2)11-15(3)12-16(4)17/h14-16H,5-13H2,1-4H3 |
| InChIKey | GZCMWHQEFBLUPQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.89 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|