C32H65BrO2 — CID 172545087
1-bromo-4,6,8,10,12,14-hexamethyl-17-(octoxymethoxy)heptadecane (PubChem CID 172545087) has the molecular formula C32H65BrO2 and a molecular weight of 561.77 g/mol. Its IUPAC name is 1-bromo-4,6,8,10,12,14-hexamethyl-17-(octoxymethoxy)heptadecane.
| Compound Name | 1-bromo-4,6,8,10,12,14-hexamethyl-17-(octoxymethoxy)heptadecane |
|---|---|
| PubChem CID | 172545087 |
| Molecular Formula | C32H65BrO2 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 560.42 |
| IUPAC Name | 1-bromo-4,6,8,10,12,14-hexamethyl-17-(octoxymethoxy)heptadecane |
| SMILES | CCCCCCCCOCOCCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CCCBr |
| InChI | InChI=1S/C32H65BrO2/c1-8-9-10-11-12-13-19-34-26-35-20-15-17-28(3)22-30(5)24-32(7)25-31(6)23-29(4)21-27(2)16-14-18-33/h27-32H,8-26H2,1-7H3 |
| InChIKey | HLRUYYVOIVALMR-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|