C31H63IO2 — CID 172545369
1-(decoxymethoxy)-14-iodo-4,6,8,10,12-pentamethylpentadecane (PubChem CID 172545369) has the molecular formula C31H63IO2 and a molecular weight of 594.75 g/mol. Its IUPAC name is 1-(decoxymethoxy)-14-iodo-4,6,8,10,12-pentamethylpentadecane.
| Compound Name | 1-(decoxymethoxy)-14-iodo-4,6,8,10,12-pentamethylpentadecane |
|---|---|
| PubChem CID | 172545369 |
| Molecular Formula | C31H63IO2 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.39 |
| IUPAC Name | 1-(decoxymethoxy)-14-iodo-4,6,8,10,12-pentamethylpentadecane |
| SMILES | CCCCCCCCCCOCOCCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)I |
| InChI | InChI=1S/C31H63IO2/c1-8-9-10-11-12-13-14-15-18-33-25-34-19-16-17-26(2)20-27(3)21-28(4)22-29(5)23-30(6)24-31(7)32/h26-31H,8-25H2,1-7H3 |
| InChIKey | ZGBBNESEPHZZDT-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|