C17H36O3 — CID 172545297
4,6-dimethyl-9-(pentoxymethoxy)nonan-2-ol (PubChem CID 172545297) has the molecular formula C17H36O3 and a molecular weight of 288.47 g/mol. Its IUPAC name is 4,6-dimethyl-9-(pentoxymethoxy)nonan-2-ol.
| Compound Name | 4,6-dimethyl-9-(pentoxymethoxy)nonan-2-ol |
|---|---|
| PubChem CID | 172545297 |
| Molecular Formula | C17H36O3 |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.27 |
| IUPAC Name | 4,6-dimethyl-9-(pentoxymethoxy)nonan-2-ol |
| SMILES | CCCCCOCOCCCC(C)CC(C)CC(C)O |
| InChI | InChI=1S/C17H36O3/c1-5-6-7-10-19-14-20-11-8-9-15(2)12-16(3)13-17(4)18/h15-18H,5-14H2,1-4H3 |
| InChIKey | XERHVIPJTHLTFB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|