C64H128I2O3 — CID 176549096
20-iodo-1-(20-iodo-5,7,9,11,13,15,17-heptamethyl-1-pentoxyicosoxy)-5,7,9,11,13,15,17-heptamethyl-1-pentoxyicosane (PubChem CID 176549096) has the molecular formula C64H128I2O3 and a molecular weight of 1199.53 g/mol. Its IUPAC name is 20-iodo-1-(20-iodo-5,7,9,11,13,15,17-heptamethyl-1-pentoxyicosoxy)-5,7,9,11,13,15,17-heptamethyl-1-pentoxyicosane.
| Compound Name | 20-iodo-1-(20-iodo-5,7,9,11,13,15,17-heptamethyl-1-pentoxyicosoxy)-5,7,9,11,13,15,17-heptamethyl-1-pentoxyicosane |
|---|---|
| PubChem CID | 176549096 |
| Molecular Formula | C64H128I2O3 |
| Molecular Weight | 1199.53 g/mol |
| Exact Mass | 1198.80 |
| IUPAC Name | 20-iodo-1-(20-iodo-5,7,9,11,13,15,17-heptamethyl-1-pentoxyicosoxy)-5,7,9,11,13,15,17-heptamethyl-1-pentoxyicosane |
| SMILES | CCCCCOC(CCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CCCI)OC(CCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CCCI)OCCCCC |
| InChI | InChI=1S/C64H128I2O3/c1-17-19-21-35-67-63(31-23-27-49(3)37-53(7)41-57(11)45-61(15)47-59(13)43-55(9)39-51(5)29-25-33-65)69-64(68-36-22-20-18-2)32-24-28-50(4)38-54(8)42-58(12)46-62(16)48-60(14)44-56(10)40-52(6)30-26-34-66/h49-64H,17-48H2,1-16H3 |
| InChIKey | PRNFWCTZNBZKRX-UHFFFAOYSA-N |
| XLogP | 22.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1199.53 |
| LogP ≤ 5 | 22.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|