C62H124I2O3 — CID 176549090
1-butoxy-1-(1-butoxy-20-iodo-5,7,9,11,13,15,17-heptamethylicosoxy)-20-iodo-5,7,9,11,13,15,17-heptamethylicosane (PubChem CID 176549090) has the molecular formula C62H124I2O3 and a molecular weight of 1171.48 g/mol. Its IUPAC name is 1-butoxy-1-(1-butoxy-20-iodo-5,7,9,11,13,15,17-heptamethylicosoxy)-20-iodo-5,7,9,11,13,15,17-heptamethylicosane.
| Compound Name | 1-butoxy-1-(1-butoxy-20-iodo-5,7,9,11,13,15,17-heptamethylicosoxy)-20-iodo-5,7,9,11,13,15,17-heptamethylicosane |
|---|---|
| PubChem CID | 176549090 |
| Molecular Formula | C62H124I2O3 |
| Molecular Weight | 1171.48 g/mol |
| Exact Mass | 1170.76 |
| IUPAC Name | 1-butoxy-1-(1-butoxy-20-iodo-5,7,9,11,13,15,17-heptamethylicosoxy)-20-iodo-5,7,9,11,13,15,17-heptamethylicosane |
| SMILES | CCCCOC(CCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CCCI)OC(CCCC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CC(C)CCCI)OCCCC |
| InChI | InChI=1S/C62H124I2O3/c1-17-19-33-65-61(29-21-25-47(3)35-51(7)39-55(11)43-59(15)45-57(13)41-53(9)37-49(5)27-23-31-63)67-62(66-34-20-18-2)30-22-26-48(4)36-52(8)40-56(12)44-60(16)46-58(14)42-54(10)38-50(6)28-24-32-64/h47-62H,17-46H2,1-16H3 |
| InChIKey | AJBFWOHAZPZIKW-UHFFFAOYSA-N |
| XLogP | 21.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1171.48 |
| LogP ≤ 5 | 21.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|