C20H23N3O4 — CID 172548881
methyl 4-[5-(4-aminobutylcarbamoyl)furan-2-yl]-2-(3-aminoprop-1-ynyl)benzoate (PubChem CID 172548881) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl 4-[5-(4-aminobutylcarbamoyl)furan-2-yl]-2-(3-aminoprop-1-ynyl)benzoate.
| Compound Name | methyl 4-[5-(4-aminobutylcarbamoyl)furan-2-yl]-2-(3-aminoprop-1-ynyl)benzoate |
|---|---|
| PubChem CID | 172548881 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | methyl 4-[5-(4-aminobutylcarbamoyl)furan-2-yl]-2-(3-aminoprop-1-ynyl)benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C(=O)NCCCCN)o2)cc1C#CCN |
| InChI | InChI=1S/C20H23N3O4/c1-26-20(25)16-7-6-15(13-14(16)5-4-11-22)17-8-9-18(27-17)19(24)23-12-3-2-10-21/h6-9,13H,2-3,10-12,21-22H2,1H3,(H,23,24) |
| InChIKey | YMNNGBXKOOULLX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|