C16H32N2O9 — CID 172549205
6-[1,3-bis(1,3-dihydroxypropan-2-yloxy)propan-2-ylcarbamoylamino]hexanoic acid (PubChem CID 172549205) has the molecular formula C16H32N2O9 and a molecular weight of 396.44 g/mol. Its IUPAC name is 6-[1,3-bis(1,3-dihydroxypropan-2-yloxy)propan-2-ylcarbamoylamino]hexanoic acid.
| Compound Name | 6-[1,3-bis(1,3-dihydroxypropan-2-yloxy)propan-2-ylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 172549205 |
| Molecular Formula | C16H32N2O9 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 6-[1,3-bis(1,3-dihydroxypropan-2-yloxy)propan-2-ylcarbamoylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)NC(COC(CO)CO)COC(CO)CO |
| InChI | InChI=1S/C16H32N2O9/c19-6-13(7-20)26-10-12(11-27-14(8-21)9-22)18-16(25)17-5-3-1-2-4-15(23)24/h12-14,19-22H,1-11H2,(H,23,24)(H2,17,18,25) |
| InChIKey | SNJIOZSIEJHNCK-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 177.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|