C24H33N5 — CID 172549408
1-[(3S,10R,13S)-3-azido-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-ethylimidazole (PubChem CID 172549408) has the molecular formula C24H33N5 and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-[(3S,10R,13S)-3-azido-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-ethylimidazole.
| Compound Name | 1-[(3S,10R,13S)-3-azido-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-ethylimidazole |
|---|---|
| PubChem CID | 172549408 |
| Molecular Formula | C24H33N5 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 1-[(3S,10R,13S)-3-azido-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-ethylimidazole |
| SMILES | CCc1cn(C2=CCC3C4CC=C5C[C@@H](N=[N+]=[N-])CC[C@]5(C)C4CC[C@]23C)cn1 |
| InChI | InChI=1S/C24H33N5/c1-4-17-14-29(15-26-17)22-8-7-20-19-6-5-16-13-18(27-28-25)9-11-23(16,2)21(19)10-12-24(20,22)3/h5,8,14-15,18-21H,4,6-7,9-13H2,1-3H3/t18-,19?,20?,21?,23-,24-/m0/s1 |
| InChIKey | BXIRGFQUTOSQFJ-IPYNFABXSA-N |
| XLogP | 6.54 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|