C23H28F3N5 — CID 172549401
1-[(3S,10R,13S)-3-azido-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-(trifluoromethyl)imidazole (PubChem CID 172549401) has the molecular formula C23H28F3N5 and a molecular weight of 431.51 g/mol. Its IUPAC name is 1-[(3S,10R,13S)-3-azido-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-(trifluoromethyl)imidazole.
| Compound Name | 1-[(3S,10R,13S)-3-azido-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 172549401 |
| Molecular Formula | C23H28F3N5 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 1-[(3S,10R,13S)-3-azido-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-(trifluoromethyl)imidazole |
| SMILES | C[C@]12CC[C@H](N=[N+]=[N-])CC1=CCC1C2CC[C@]2(C)C(n3cnc(C(F)(F)F)c3)=CCC12 |
| InChI | InChI=1S/C23H28F3N5/c1-21-9-7-15(29-30-27)11-14(21)3-4-16-17-5-6-20(22(17,2)10-8-18(16)21)31-12-19(28-13-31)23(24,25)26/h3,6,12-13,15-18H,4-5,7-11H2,1-2H3/t15-,16?,17?,18?,21-,22-/m0/s1 |
| InChIKey | JAXSOEZBTXFCKZ-QHRGDQGKSA-N |
| XLogP | 6.99 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|