C26H34N2O6 — CID 172550920
N-[(7S,9S)-9-hydroxy-1,2,3-trimethoxy-10-morpholin-4-yl-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]propanamide (PubChem CID 172550920) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[(7S,9S)-9-hydroxy-1,2,3-trimethoxy-10-morpholin-4-yl-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]propanamide.
| Compound Name | N-[(7S,9S)-9-hydroxy-1,2,3-trimethoxy-10-morpholin-4-yl-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]propanamide |
|---|---|
| PubChem CID | 172550920 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | N-[(7S,9S)-9-hydroxy-1,2,3-trimethoxy-10-morpholin-4-yl-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]propanamide |
| SMILES | CCC(=O)N[C@H]1CCc2cc(OC)c(OC)c(OC)c2C2=CC=C(N3CCOCC3)[C@@H](O)C=C21 |
| InChI | InChI=1S/C26H34N2O6/c1-5-23(30)27-19-8-6-16-14-22(31-2)25(32-3)26(33-4)24(16)17-7-9-20(21(29)15-18(17)19)28-10-12-34-13-11-28/h7,9,14-15,19,21,29H,5-6,8,10-13H2,1-4H3,(H,27,30)/t19-,21-/m0/s1 |
| InChIKey | RSOBZXWTNYCVPO-FPOVZHCZSA-N |
| XLogP | 2.45 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |