C24H28F3NO6 — CID 172550936
N-[(7S,10S)-10-hydroxy-1,2,3-trimethoxy-11-methyl-9-(2,2,2-trifluoroethoxy)-5,6,7,10-tetrahydrobenzo[a]heptalen-7-yl]acetamide (PubChem CID 172550936) has the molecular formula C24H28F3NO6 and a molecular weight of 483.48 g/mol. Its IUPAC name is N-[(7S,10S)-10-hydroxy-1,2,3-trimethoxy-11-methyl-9-(2,2,2-trifluoroethoxy)-5,6,7,10-tetrahydrobenzo[a]heptalen-7-yl]acetamide.
| Compound Name | N-[(7S,10S)-10-hydroxy-1,2,3-trimethoxy-11-methyl-9-(2,2,2-trifluoroethoxy)-5,6,7,10-tetrahydrobenzo[a]heptalen-7-yl]acetamide |
|---|---|
| PubChem CID | 172550936 |
| Molecular Formula | C24H28F3NO6 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | N-[(7S,10S)-10-hydroxy-1,2,3-trimethoxy-11-methyl-9-(2,2,2-trifluoroethoxy)-5,6,7,10-tetrahydrobenzo[a]heptalen-7-yl]acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)C1=C(C=C(OCC(F)(F)F)[C@@H](O)C(C)=C1)[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C24H28F3NO6/c1-12-8-16-15(10-18(21(12)30)34-11-24(25,26)27)17(28-13(2)29)7-6-14-9-19(31-3)22(32-4)23(33-5)20(14)16/h8-10,17,21,30H,6-7,11H2,1-5H3,(H,28,29)/t17-,21-/m0/s1 |
| InChIKey | CJVTXXHVNHHVAB-UWJYYQICSA-N |
| XLogP | 3.70 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |