C21H23NO4 — CID 142905857
N-(1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide (PubChem CID 142905857) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-(1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide.
| Compound Name | N-(1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide |
|---|---|
| PubChem CID | 142905857 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-(1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)C1=C(C=CC=C=C1)C(NC(C)=O)CC2 |
| InChI | InChI=1S/C21H23NO4/c1-13(23)22-17-11-10-14-12-18(24-2)20(25-3)21(26-4)19(14)16-9-7-5-6-8-15(16)17/h5-6,8-9,12,17H,10-11H2,1-4H3,(H,22,23) |
| InChIKey | GXLVJOGODWTNMZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |