C27H27FN4O8 — CID 172551423
methyl 2-[(19S)-19-(2-aminoethylcarbamoyloxy)-19-ethyl-6-fluoro-7-methoxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]acetate (PubChem CID 172551423) has the molecular formula C27H27FN4O8 and a molecular weight of 554.53 g/mol. Its IUPAC name is methyl 2-[(19S)-19-(2-aminoethylcarbamoyloxy)-19-ethyl-6-fluoro-7-methoxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]acetate.
| Compound Name | methyl 2-[(19S)-19-(2-aminoethylcarbamoyloxy)-19-ethyl-6-fluoro-7-methoxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]acetate |
|---|---|
| PubChem CID | 172551423 |
| Molecular Formula | C27H27FN4O8 |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | methyl 2-[(19S)-19-(2-aminoethylcarbamoyloxy)-19-ethyl-6-fluoro-7-methoxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]acetate |
| SMILES | CC[C@@]1(OC(=O)NCCN)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(OC)cc1c2CC(=O)OC |
| InChI | InChI=1S/C27H27FN4O8/c1-4-27(40-26(36)30-6-5-29)17-9-20-23-15(11-32(20)24(34)16(17)12-39-25(27)35)13(8-22(33)38-3)14-7-21(37-2)18(28)10-19(14)31-23/h7,9-10H,4-6,8,11-12,29H2,1-3H3,(H,30,36)/t27-/m0/s1 |
| InChIKey | STMDLGGSFGCFGS-MHZLTWQESA-N |
| XLogP | 1.64 |
| TPSA | 161.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|