C8H8N4 — CID 172552183
6H-pyrimido[5,4-c]azepin-4-amine (PubChem CID 172552183) has the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. Its IUPAC name is 6H-pyrimido[5,4-c]azepin-4-amine.
| Compound Name | 6H-pyrimido[5,4-c]azepin-4-amine |
|---|---|
| PubChem CID | 172552183 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 6H-pyrimido[5,4-c]azepin-4-amine |
| SMILES | Nc1ncnc2c1=CNC=CC=2 |
| InChI | InChI=1S/C8H8N4/c9-8-6-4-10-3-1-2-7(6)11-5-12-8/h1-5,10H,(H2,9,11,12) |
| InChIKey | DXTJGOPRGAJBNP-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |