C11H10FN3O3 — CID 172552791
5-(2-fluoro-4-nitrophenoxy)-1,3-dimethylpyrazole (PubChem CID 172552791) has the molecular formula C11H10FN3O3 and a molecular weight of 251.22 g/mol. Its IUPAC name is 5-(2-fluoro-4-nitrophenoxy)-1,3-dimethylpyrazole.
| Compound Name | 5-(2-fluoro-4-nitrophenoxy)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 172552791 |
| Molecular Formula | C11H10FN3O3 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 5-(2-fluoro-4-nitrophenoxy)-1,3-dimethylpyrazole |
| SMILES | Cc1cc(Oc2ccc([N+](=O)[O-])cc2F)n(C)n1 |
| InChI | InChI=1S/C11H10FN3O3/c1-7-5-11(14(2)13-7)18-10-4-3-8(15(16)17)6-9(10)12/h3-6H,1-2H3 |
| InChIKey | AGDZNRDCNUXHDL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|