C34H21F2NO4 — CID 172553220
methyl 4-[2,7-bis(3-fluoro-4-formylphenyl)carbazol-9-yl]benzoate (PubChem CID 172553220) has the molecular formula C34H21F2NO4 and a molecular weight of 545.54 g/mol. Its IUPAC name is methyl 4-[2,7-bis(3-fluoro-4-formylphenyl)carbazol-9-yl]benzoate.
| Compound Name | methyl 4-[2,7-bis(3-fluoro-4-formylphenyl)carbazol-9-yl]benzoate |
|---|---|
| PubChem CID | 172553220 |
| Molecular Formula | C34H21F2NO4 |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | methyl 4-[2,7-bis(3-fluoro-4-formylphenyl)carbazol-9-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2c3cc(-c4ccc(C=O)c(F)c4)ccc3c3ccc(-c4ccc(C=O)c(F)c4)cc32)cc1 |
| InChI | InChI=1S/C34H21F2NO4/c1-41-34(40)20-6-10-27(11-7-20)37-32-16-23(21-2-4-25(18-38)30(35)14-21)8-12-28(32)29-13-9-24(17-33(29)37)22-3-5-26(19-39)31(36)15-22/h2-19H,1H3 |
| InChIKey | RDMOPPARBXEDPH-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|