C11H20O4 — CID 172555447
2-(hydroxymethyl)-2-(3-methylpenta-1,4-dien-3-yloxymethyl)propane-1,3-diol (PubChem CID 172555447) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-(3-methylpenta-1,4-dien-3-yloxymethyl)propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-(3-methylpenta-1,4-dien-3-yloxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 172555447 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-(hydroxymethyl)-2-(3-methylpenta-1,4-dien-3-yloxymethyl)propane-1,3-diol |
| SMILES | C=CC(C)(C=C)OCC(CO)(CO)CO |
| InChI | InChI=1S/C11H20O4/c1-4-10(3,5-2)15-9-11(6-12,7-13)8-14/h4-5,12-14H,1-2,6-9H2,3H3 |
| InChIKey | XVJWEHLZMOJAMT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|