About bis(hexadec-8-enoic acid);zinc
bis(hexadec-8-enoic acid);zinc (PubChem CID 172555663) has the molecular formula C32H60O4Zn
and a molecular weight of 574.22 g/mol. Its IUPAC name is bis(hexadec-8-enoic acid);zinc.
Molecular Properties
| Compound Name | bis(hexadec-8-enoic acid);zinc |
| PubChem CID | 172555663 |
| Molecular Formula | C32H60O4Zn |
| Molecular Weight | 574.22 g/mol |
| Exact Mass | 572.38 |
| IUPAC Name | bis(hexadec-8-enoic acid);zinc |
| SMILES | CCCCCCCC=CCCCCCCC(=O)O.CCCCCCCC=CCCCCCCC(=O)O.[Zn] |
| InChI | InChI=1S/2C16H30O2.Zn/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2*8-9H,2-7,10-15H2,1H3,(H,17,18); |
| InChIKey | ZPSSDGFFKZMCDX-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 574.22 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(hexadec-8-enoic acid);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(hexadec-8-enoic acid);zinc?
The IUPAC name of bis(hexadec-8-enoic acid);zinc (CID 172555663) is bis(hexadec-8-enoic acid);zinc.
What is the SMILES notation for bis(hexadec-8-enoic acid);zinc?
The canonical SMILES for bis(hexadec-8-enoic acid);zinc is CCCCCCCC=CCCCCCCC(=O)O.CCCCCCCC=CCCCCCCC(=O)O.[Zn].
What is the InChIKey of bis(hexadec-8-enoic acid);zinc?
The InChIKey is ZPSSDGFFKZMCDX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H30O2.Zn/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2*8-9H,2-7,10-15H2,1H3,(H,17,18);.
What are the key properties of bis(hexadec-8-enoic acid);zinc?
bis(hexadec-8-enoic acid);zinc has a molecular weight of 574.22 g/mol, XLogP of 10.65, 26 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(hexadec-8-enoic acid);zinc is sourced from PubChem (CID 172555663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).