C14H17FO4S — CID 172558037
2-(5-fluoro-3-methyl-1-benzofuran-2-yl)-3-methylbutane-2-sulfonic acid (PubChem CID 172558037) has the molecular formula C14H17FO4S and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-(5-fluoro-3-methyl-1-benzofuran-2-yl)-3-methylbutane-2-sulfonic acid.
| Compound Name | 2-(5-fluoro-3-methyl-1-benzofuran-2-yl)-3-methylbutane-2-sulfonic acid |
|---|---|
| PubChem CID | 172558037 |
| Molecular Formula | C14H17FO4S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-(5-fluoro-3-methyl-1-benzofuran-2-yl)-3-methylbutane-2-sulfonic acid |
| SMILES | Cc1c(C(C)(C(C)C)S(=O)(=O)O)oc2ccc(F)cc12 |
| InChI | InChI=1S/C14H17FO4S/c1-8(2)14(4,20(16,17)18)13-9(3)11-7-10(15)5-6-12(11)19-13/h5-8H,1-4H3,(H,16,17,18) |
| InChIKey | VBCBPERWBWEJDX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|