C36H40N8O2S — CID 172558436
methyl 7-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-3-[5-methyl-6-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)pyridazin-3-yl]imidazo[1,2-a]pyridine-8-carboxylate (PubChem CID 172558436) has the molecular formula C36H40N8O2S and a molecular weight of 648.84 g/mol. Its IUPAC name is methyl 7-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-3-[5-methyl-6-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)pyridazin-3-yl]imidazo[1,2-a]pyridine-8-carboxylate.
| Compound Name | methyl 7-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-3-[5-methyl-6-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)pyridazin-3-yl]imidazo[1,2-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 172558436 |
| Molecular Formula | C36H40N8O2S |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.30 |
| IUPAC Name | methyl 7-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-3-[5-methyl-6-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)pyridazin-3-yl]imidazo[1,2-a]pyridine-8-carboxylate |
| SMILES | COC(=O)c1c(-c2cnn(CC34CC5CC(CC(C5)C3)C4)c2C)ccn2c(-c3cc(C)c(Nc4nc5c(s4)CCCC5)nn3)cnc12 |
| InChI | InChI=1S/C36H40N8O2S/c1-20-10-28(41-42-32(20)40-35-39-27-6-4-5-7-30(27)47-35)29-18-37-33-31(34(45)46-3)25(8-9-43(29)33)26-17-38-44(21(26)2)19-36-14-22-11-23(15-36)13-24(12-22)16-36/h8-10,17-18,22-24H,4-7,11-16,19H2,1-3H3,(H,39,40,42) |
| InChIKey | GOFVSEHTHLZQCY-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |