C31H35N5O2 — CID 176885167
ethyl 7-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-3-(4-aminophenyl)imidazo[1,2-a]pyridine-8-carboxylate (PubChem CID 176885167) has the molecular formula C31H35N5O2 and a molecular weight of 509.65 g/mol. Its IUPAC name is ethyl 7-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-3-(4-aminophenyl)imidazo[1,2-a]pyridine-8-carboxylate.
| Compound Name | ethyl 7-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-3-(4-aminophenyl)imidazo[1,2-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 176885167 |
| Molecular Formula | C31H35N5O2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | ethyl 7-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-3-(4-aminophenyl)imidazo[1,2-a]pyridine-8-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cnn(CC34CC5CC(CC(C5)C3)C4)c2C)ccn2c(-c3ccc(N)cc3)cnc12 |
| InChI | InChI=1S/C31H35N5O2/c1-3-38-30(37)28-25(8-9-35-27(17-33-29(28)35)23-4-6-24(32)7-5-23)26-16-34-36(19(26)2)18-31-13-20-10-21(14-31)12-22(11-20)15-31/h4-9,16-17,20-22H,3,10-15,18,32H2,1-2H3 |
| InChIKey | AGFPETPDZIQBKQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|