C25H28N4O2 — CID 172558476
7-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-4-aminoquinoline-8-carboxylic acid (PubChem CID 172558476) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 7-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-4-aminoquinoline-8-carboxylic acid.
| Compound Name | 7-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-4-aminoquinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 172558476 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 7-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-4-aminoquinoline-8-carboxylic acid |
| SMILES | Cc1c(-c2ccc3c(N)ccnc3c2C(=O)O)cnn1CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H28N4O2/c1-14-20(18-2-3-19-21(26)4-5-27-23(19)22(18)24(30)31)12-28-29(14)13-25-9-15-6-16(10-25)8-17(7-15)11-25/h2-5,12,15-17H,6-11,13H2,1H3,(H2,26,27)(H,30,31) |
| InChIKey | YMGRTGKOOSTEBP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |