C26H28ClN3O2 — CID 172558435
methyl 6-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-2-chloroquinoline-5-carboxylate (PubChem CID 172558435) has the molecular formula C26H28ClN3O2 and a molecular weight of 449.98 g/mol. Its IUPAC name is methyl 6-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-2-chloroquinoline-5-carboxylate.
| Compound Name | methyl 6-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-2-chloroquinoline-5-carboxylate |
|---|---|
| PubChem CID | 172558435 |
| Molecular Formula | C26H28ClN3O2 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | methyl 6-[1-(1-adamantylmethyl)-5-methylpyrazol-4-yl]-2-chloroquinoline-5-carboxylate |
| SMILES | COC(=O)c1c(-c2cnn(CC34CC5CC(CC(C5)C3)C4)c2C)ccc2nc(Cl)ccc12 |
| InChI | InChI=1S/C26H28ClN3O2/c1-15-21(19-3-5-22-20(4-6-23(27)29-22)24(19)25(31)32-2)13-28-30(15)14-26-10-16-7-17(11-26)9-18(8-16)12-26/h3-6,13,16-18H,7-12,14H2,1-2H3 |
| InChIKey | UYZQWNMZQIVGDM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|