C35H38N8O2S — CID 176618431
methyl 7-[1-(1-adamantylmethyl)pyrazol-4-yl]-3-[5-methyl-6-(2,3,4,5-tetrahydro-1,3-benzothiazol-2-ylamino)pyridazin-3-yl]imidazo[1,2-a]pyridine-8-carboxylate (PubChem CID 176618431) has the molecular formula C35H38N8O2S and a molecular weight of 634.81 g/mol. Its IUPAC name is methyl 7-[1-(1-adamantylmethyl)pyrazol-4-yl]-3-[5-methyl-6-(2,3,4,5-tetrahydro-1,3-benzothiazol-2-ylamino)pyridazin-3-yl]imidazo[1,2-a]pyridine-8-carboxylate.
| Compound Name | methyl 7-[1-(1-adamantylmethyl)pyrazol-4-yl]-3-[5-methyl-6-(2,3,4,5-tetrahydro-1,3-benzothiazol-2-ylamino)pyridazin-3-yl]imidazo[1,2-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 176618431 |
| Molecular Formula | C35H38N8O2S |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | methyl 7-[1-(1-adamantylmethyl)pyrazol-4-yl]-3-[5-methyl-6-(2,3,4,5-tetrahydro-1,3-benzothiazol-2-ylamino)pyridazin-3-yl]imidazo[1,2-a]pyridine-8-carboxylate |
| SMILES | COC(=O)c1c(-c2cnn(CC34CC5CC(CC(C5)C3)C4)c2)ccn2c(-c3cc(C)c(NC4NC5=C(C=CCC5)S4)nn3)cnc12 |
| InChI | InChI=1S/C35H38N8O2S/c1-20-9-27(40-41-31(20)39-34-38-26-5-3-4-6-29(26)46-34)28-17-36-32-30(33(44)45-2)25(7-8-43(28)32)24-16-37-42(18-24)19-35-13-21-10-22(14-35)12-23(11-21)15-35/h4,6-9,16-18,21-23,34,38H,3,5,10-15,19H2,1-2H3,(H,39,41) |
| InChIKey | WWWWHATWGYEZFR-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |