C9H21NO4S — CID 172559433
azanium (1,2,2-trimethylcyclohexyl) sulfate (PubChem CID 172559433) has the molecular formula C9H21NO4S and a molecular weight of 239.34 g/mol. Its IUPAC name is azanium (1,2,2-trimethylcyclohexyl) sulfate.
| Compound Name | azanium (1,2,2-trimethylcyclohexyl) sulfate |
|---|---|
| PubChem CID | 172559433 |
| Molecular Formula | C9H21NO4S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | azanium (1,2,2-trimethylcyclohexyl) sulfate |
| SMILES | CC1(C)CCCCC1(C)OS(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C9H18O4S.H3N/c1-8(2)6-4-5-7-9(8,3)13-14(10,11)12;/h4-7H2,1-3H3,(H,10,11,12);1H3 |
| InChIKey | OHSJTZGRUWGBIB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|