methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid

C10H21NO3S — CID 22996865

IUPACmethyl-(1,2,2-trimethylcyclohexyl)sulfamic acid
SMILESCN(C1(C)CCCCC1(C)C)S(=O)(=O)O
InChIInChI=1S/C10H21NO3S/c1-9(2)7-5-6-8-10(9,3)11(4)15(12,13)14/h5-8H2,1-4H3,(H,12,13,14)
InChIKeyBVGFBPRRONDAPN-UHFFFAOYSA-N
MW235.35 g/mol
LogP2.08
Rot. Bonds2

About methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid

methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid (PubChem CID 22996865) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid.

Molecular Properties

Compound Namemethyl-(1,2,2-trimethylcyclohexyl)sulfamic acid
PubChem CID22996865
Molecular FormulaC10H21NO3S
Molecular Weight235.35 g/mol
Exact Mass235.12
IUPAC Namemethyl-(1,2,2-trimethylcyclohexyl)sulfamic acid
SMILESCN(C1(C)CCCCC1(C)C)S(=O)(=O)O
InChIInChI=1S/C10H21NO3S/c1-9(2)7-5-6-8-10(9,3)11(4)15(12,13)14/h5-8H2,1-4H3,(H,12,13,14)
InChIKeyBVGFBPRRONDAPN-UHFFFAOYSA-N
XLogP2.08
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.35
LogP ≤ 52.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid?
The IUPAC name of methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid (CID 22996865) is methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid.
What is the SMILES notation for methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid?
The canonical SMILES for methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid is CN(C1(C)CCCCC1(C)C)S(=O)(=O)O.
What is the InChIKey of methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid?
The InChIKey is BVGFBPRRONDAPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3S/c1-9(2)7-5-6-8-10(9,3)11(4)15(12,13)14/h5-8H2,1-4H3,(H,12,13,14).
What are the key properties of methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid?
methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid has a molecular weight of 235.35 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid is sourced from PubChem (CID 22996865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).