C10H21NO3S — CID 22996865
methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid (PubChem CID 22996865) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid.
| Compound Name | methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid |
|---|---|
| PubChem CID | 22996865 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | methyl-(1,2,2-trimethylcyclohexyl)sulfamic acid |
| SMILES | CN(C1(C)CCCCC1(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C10H21NO3S/c1-9(2)7-5-6-8-10(9,3)11(4)15(12,13)14/h5-8H2,1-4H3,(H,12,13,14) |
| InChIKey | BVGFBPRRONDAPN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|