C15H26N4O3Si — CID 172560264
tert-butyl (2S)-4-oxo-2-(1-trimethylsilyltriazol-4-yl)piperidine-1-carboxylate (PubChem CID 172560264) has the molecular formula C15H26N4O3Si and a molecular weight of 338.48 g/mol. Its IUPAC name is tert-butyl (2S)-4-oxo-2-(1-trimethylsilyltriazol-4-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-oxo-2-(1-trimethylsilyltriazol-4-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172560264 |
| Molecular Formula | C15H26N4O3Si |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | tert-butyl (2S)-4-oxo-2-(1-trimethylsilyltriazol-4-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C[C@H]1c1cn([Si](C)(C)C)nn1 |
| InChI | InChI=1S/C15H26N4O3Si/c1-15(2,3)22-14(21)18-8-7-11(20)9-13(18)12-10-19(17-16-12)23(4,5)6/h10,13H,7-9H2,1-6H3/t13-/m0/s1 |
| InChIKey | XKOCMGVESKFTGC-ZDUSSCGKSA-N |
| XLogP | 2.60 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|