C19H18N4O2 — CID 172562906
4-ethynyl-7-(3-methoxy-2,6-dimethylphenyl)-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 172562906) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 4-ethynyl-7-(3-methoxy-2,6-dimethylphenyl)-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-ethynyl-7-(3-methoxy-2,6-dimethylphenyl)-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 172562906 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-ethynyl-7-(3-methoxy-2,6-dimethylphenyl)-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | C#Cc1nc(C)nc2c1c(C(N)=O)cn2-c1c(C)ccc(OC)c1C |
| InChI | InChI=1S/C19H18N4O2/c1-6-14-16-13(18(20)24)9-23(19(16)22-12(4)21-14)17-10(2)7-8-15(25-5)11(17)3/h1,7-9H,2-5H3,(H2,20,24) |
| InChIKey | CVLWVZLAWYQFCD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|