About (3-carbamoylphenyl) thiocyanate
(3-carbamoylphenyl) thiocyanate (PubChem CID 172564118) has the molecular formula C8H6N2OS
and a molecular weight of 178.22 g/mol. Its IUPAC name is (3-carbamoylphenyl) thiocyanate.
Molecular Properties
| Compound Name | (3-carbamoylphenyl) thiocyanate |
| PubChem CID | 172564118 |
| Molecular Formula | C8H6N2OS |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | (3-carbamoylphenyl) thiocyanate |
| SMILES | N#CSc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C8H6N2OS/c9-5-12-7-3-1-2-6(4-7)8(10)11/h1-4H,(H2,10,11) |
| InChIKey | PIKPRSHPMOZVKI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (3-carbamoylphenyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-carbamoylphenyl) thiocyanate?
The IUPAC name of (3-carbamoylphenyl) thiocyanate (CID 172564118) is (3-carbamoylphenyl) thiocyanate.
What is the SMILES notation for (3-carbamoylphenyl) thiocyanate?
The canonical SMILES for (3-carbamoylphenyl) thiocyanate is N#CSc1cccc(C(N)=O)c1.
What is the InChIKey of (3-carbamoylphenyl) thiocyanate?
The InChIKey is PIKPRSHPMOZVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2OS/c9-5-12-7-3-1-2-6(4-7)8(10)11/h1-4H,(H2,10,11).
What are the key properties of (3-carbamoylphenyl) thiocyanate?
(3-carbamoylphenyl) thiocyanate has a molecular weight of 178.22 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-carbamoylphenyl) thiocyanate is sourced from PubChem (CID 172564118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).