C14H20N4O8 — CID 172564715
4-[2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoylamino]butanoic acid;formic acid (PubChem CID 172564715) has the molecular formula C14H20N4O8 and a molecular weight of 372.33 g/mol. Its IUPAC name is 4-[2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoylamino]butanoic acid;formic acid.
| Compound Name | 4-[2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoylamino]butanoic acid;formic acid |
|---|---|
| PubChem CID | 172564715 |
| Molecular Formula | C14H20N4O8 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 4-[2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoylamino]butanoic acid;formic acid |
| SMILES | CC(NC(=O)Cn1ccc(=O)[nH]c1=O)C(=O)NCCCC(=O)O.O=CO |
| InChI | InChI=1S/C13H18N4O6.CH2O2/c1-8(12(22)14-5-2-3-11(20)21)15-10(19)7-17-6-4-9(18)16-13(17)23;2-1-3/h4,6,8H,2-3,5,7H2,1H3,(H,14,22)(H,15,19)(H,20,21)(H,16,18,23);1H,(H,2,3) |
| InChIKey | NMAWPIOHICDVLL-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 187.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|