C24H32N2O5 — CID 17256689
N-[2-(butylcarbamoyl)phenyl]-3,4,5-triethoxybenzamide (PubChem CID 17256689) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-[2-(butylcarbamoyl)phenyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[2-(butylcarbamoyl)phenyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 17256689 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-[2-(butylcarbamoyl)phenyl]-3,4,5-triethoxybenzamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=O)c1cc(OCC)c(OCC)c(OCC)c1 |
| InChI | InChI=1S/C24H32N2O5/c1-5-9-14-25-24(28)18-12-10-11-13-19(18)26-23(27)17-15-20(29-6-2)22(31-8-4)21(16-17)30-7-3/h10-13,15-16H,5-9,14H2,1-4H3,(H,25,28)(H,26,27) |
| InChIKey | RKNVAWMWTZJDQX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|