C10H18N3+ — CID 172567504
1-(1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-5-yl)propane-1,2-diimine (PubChem CID 172567504) has the molecular formula C10H18N3+ and a molecular weight of 180.28 g/mol. Its IUPAC name is 1-(1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-5-yl)propane-1,2-diimine.
| Compound Name | 1-(1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-5-yl)propane-1,2-diimine |
|---|---|
| PubChem CID | 172567504 |
| Molecular Formula | C10H18N3+ |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 1-(1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-5-yl)propane-1,2-diimine |
| SMILES | [H]/N=C(C1=CCC[N+](C)(C)C1)\C(C)=N\[H] |
| InChI | InChI=1S/C10H18N3/c1-8(11)10(12)9-5-4-6-13(2,3)7-9/h5,11-12H,4,6-7H2,1-3H3/q+1/b11-8+,12-10+ |
| InChIKey | TVSPGFGMFKLXGC-TXSAMIJNSA-N |
| XLogP | 1.45 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|