About butane;ethane;2-methoxynon-1-ene
butane;ethane;2-methoxynon-1-ene (PubChem CID 172567534) has the molecular formula C18H42O
and a molecular weight of 274.53 g/mol. Its IUPAC name is butane;ethane;2-methoxynon-1-ene.
Molecular Properties
| Compound Name | butane;ethane;2-methoxynon-1-ene |
| PubChem CID | 172567534 |
| Molecular Formula | C18H42O |
| Molecular Weight | 274.53 g/mol |
| Exact Mass | 274.32 |
| IUPAC Name | butane;ethane;2-methoxynon-1-ene |
| SMILES | C=C(CCCCCCC)OC.CC.CC.CCCC |
| InChI | InChI=1S/C10H20O.C4H10.2C2H6/c1-4-5-6-7-8-9-10(2)11-3;1-3-4-2;2*1-2/h2,4-9H2,1,3H3;3-4H2,1-2H3;2*1-2H3 |
| InChIKey | HRLBQEYPZRGRQV-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.53 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butane;ethane;2-methoxynon-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;2-methoxynon-1-ene?
The IUPAC name of butane;ethane;2-methoxynon-1-ene (CID 172567534) is butane;ethane;2-methoxynon-1-ene.
What is the SMILES notation for butane;ethane;2-methoxynon-1-ene?
The canonical SMILES for butane;ethane;2-methoxynon-1-ene is C=C(CCCCCCC)OC.CC.CC.CCCC.
What is the InChIKey of butane;ethane;2-methoxynon-1-ene?
The InChIKey is HRLBQEYPZRGRQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.C4H10.2C2H6/c1-4-5-6-7-8-9-10(2)11-3;1-3-4-2;2*1-2/h2,4-9H2,1,3H3;3-4H2,1-2H3;2*1-2H3.
What are the key properties of butane;ethane;2-methoxynon-1-ene?
butane;ethane;2-methoxynon-1-ene has a molecular weight of 274.53 g/mol, XLogP of 7.37, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;2-methoxynon-1-ene is sourced from PubChem (CID 172567534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).