C20H30F3N3O4 — CID 172569324
3-amino-2-hydroxy-N-[(2S)-1-oxo-3-[4-(trifluoromethyl)piperidin-1-yl]propan-2-yl]-4-phenylbutanamide;methanol (PubChem CID 172569324) has the molecular formula C20H30F3N3O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 3-amino-2-hydroxy-N-[(2S)-1-oxo-3-[4-(trifluoromethyl)piperidin-1-yl]propan-2-yl]-4-phenylbutanamide;methanol.
| Compound Name | 3-amino-2-hydroxy-N-[(2S)-1-oxo-3-[4-(trifluoromethyl)piperidin-1-yl]propan-2-yl]-4-phenylbutanamide;methanol |
|---|---|
| PubChem CID | 172569324 |
| Molecular Formula | C20H30F3N3O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 3-amino-2-hydroxy-N-[(2S)-1-oxo-3-[4-(trifluoromethyl)piperidin-1-yl]propan-2-yl]-4-phenylbutanamide;methanol |
| SMILES | CO.NC(Cc1ccccc1)C(O)C(=O)N[C@H](C=O)CN1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H26F3N3O3.CH4O/c20-19(21,22)14-6-8-25(9-7-14)11-15(12-26)24-18(28)17(27)16(23)10-13-4-2-1-3-5-13;1-2/h1-5,12,14-17,27H,6-11,23H2,(H,24,28);2H,1H3/t15-,16?,17?;/m0./s1 |
| InChIKey | FMXAQTYUTUZGBF-ATGAPBLZSA-N |
| XLogP | 0.48 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|