C18H25BrO3 — CID 172571340
(1S,2R,4R,5S)-5-bromo-1-methyl-2-(2-phenoxyethoxy)-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane (PubChem CID 172571340) has the molecular formula C18H25BrO3 and a molecular weight of 369.30 g/mol. Its IUPAC name is (1S,2R,4R,5S)-5-bromo-1-methyl-2-(2-phenoxyethoxy)-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane.
| Compound Name | (1S,2R,4R,5S)-5-bromo-1-methyl-2-(2-phenoxyethoxy)-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 172571340 |
| Molecular Formula | C18H25BrO3 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (1S,2R,4R,5S)-5-bromo-1-methyl-2-(2-phenoxyethoxy)-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane |
| SMILES | CC(C)[C@]12C[C@@H](OCCOc3ccccc3)[C@](C)(C[C@@H]1Br)O2 |
| InChI | InChI=1S/C18H25BrO3/c1-13(2)18-12-16(17(3,22-18)11-15(18)19)21-10-9-20-14-7-5-4-6-8-14/h4-8,13,15-16H,9-12H2,1-3H3/t15-,16+,17-,18+/m0/s1 |
| InChIKey | UCCOKZBAHHBEFL-XWTMOSNGSA-N |
| XLogP | 4.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|