C15H21IO2S — CID 172571711
5-iodo-1-methyl-4-propan-2-yl-2-(thiophen-3-ylmethoxy)-7-oxabicyclo[2.2.1]heptane (PubChem CID 172571711) has the molecular formula C15H21IO2S and a molecular weight of 392.30 g/mol. Its IUPAC name is 5-iodo-1-methyl-4-propan-2-yl-2-(thiophen-3-ylmethoxy)-7-oxabicyclo[2.2.1]heptane.
| Compound Name | 5-iodo-1-methyl-4-propan-2-yl-2-(thiophen-3-ylmethoxy)-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 172571711 |
| Molecular Formula | C15H21IO2S |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 5-iodo-1-methyl-4-propan-2-yl-2-(thiophen-3-ylmethoxy)-7-oxabicyclo[2.2.1]heptane |
| SMILES | CC(C)C12CC(OCc3ccsc3)C(C)(CC1I)O2 |
| InChI | InChI=1S/C15H21IO2S/c1-10(2)15-7-13(14(3,18-15)6-12(15)16)17-8-11-4-5-19-9-11/h4-5,9-10,12-13H,6-8H2,1-3H3 |
| InChIKey | VCDWATIMQQMEBQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|