C18H22F3IO3 — CID 172571482
5-iodo-1-methyl-4-propan-2-yl-2-[[2-(trifluoromethoxy)phenyl]methoxy]-7-oxabicyclo[2.2.1]heptane (PubChem CID 172571482) has the molecular formula C18H22F3IO3 and a molecular weight of 470.27 g/mol. Its IUPAC name is 5-iodo-1-methyl-4-propan-2-yl-2-[[2-(trifluoromethoxy)phenyl]methoxy]-7-oxabicyclo[2.2.1]heptane.
| Compound Name | 5-iodo-1-methyl-4-propan-2-yl-2-[[2-(trifluoromethoxy)phenyl]methoxy]-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 172571482 |
| Molecular Formula | C18H22F3IO3 |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 5-iodo-1-methyl-4-propan-2-yl-2-[[2-(trifluoromethoxy)phenyl]methoxy]-7-oxabicyclo[2.2.1]heptane |
| SMILES | CC(C)C12CC(OCc3ccccc3OC(F)(F)F)C(C)(CC1I)O2 |
| InChI | InChI=1S/C18H22F3IO3/c1-11(2)17-9-15(16(3,25-17)8-14(17)22)23-10-12-6-4-5-7-13(12)24-18(19,20)21/h4-7,11,14-15H,8-10H2,1-3H3 |
| InChIKey | FORKERIWPWCFTB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|