C15H18N2O5 — CID 172575687
(E)-4-hydroxy-4-oxobut-2-enoate;2-(5-methoxy-1H-indol-3-yl)ethylazanium (PubChem CID 172575687) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is (E)-4-hydroxy-4-oxobut-2-enoate;2-(5-methoxy-1H-indol-3-yl)ethylazanium.
| Compound Name | (E)-4-hydroxy-4-oxobut-2-enoate;2-(5-methoxy-1H-indol-3-yl)ethylazanium |
|---|---|
| PubChem CID | 172575687 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (E)-4-hydroxy-4-oxobut-2-enoate;2-(5-methoxy-1H-indol-3-yl)ethylazanium |
| SMILES | COc1ccc2[nH]cc(CC[NH3+])c2c1.O=C([O-])/C=C/C(=O)O |
| InChI | InChI=1S/C11H14N2O.C4H4O4/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11;5-3(6)1-2-4(7)8/h2-3,6-7,13H,4-5,12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | XSFMPYDOHNPOAU-WLHGVMLRSA-N |
| XLogP | -0.66 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|