C8H8FN3O2S — CID 172576493
2-fluoro-4-methylsulfanyloxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 172576493) has the molecular formula C8H8FN3O2S and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-fluoro-4-methylsulfanyloxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-fluoro-4-methylsulfanyloxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 172576493 |
| Molecular Formula | C8H8FN3O2S |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 2-fluoro-4-methylsulfanyloxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CSOc1nc(F)nc2c1C(=O)NCC2 |
| InChI | InChI=1S/C8H8FN3O2S/c1-15-14-7-5-4(11-8(9)12-7)2-3-10-6(5)13/h2-3H2,1H3,(H,10,13) |
| InChIKey | GJSJQFMMUJJYBQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|