C64H127N3O3 — CID 172581109
N,N-didecyl-8-[[8-(didecylamino)-8-oxooctyl]-[2-[(1S,2R)-2-hydroxycyclohexyl]ethyl]amino]octanamide (PubChem CID 172581109) has the molecular formula C64H127N3O3 and a molecular weight of 986.74 g/mol. Its IUPAC name is N,N-didecyl-8-[[8-(didecylamino)-8-oxooctyl]-[2-[(1S,2R)-2-hydroxycyclohexyl]ethyl]amino]octanamide.
| Compound Name | N,N-didecyl-8-[[8-(didecylamino)-8-oxooctyl]-[2-[(1S,2R)-2-hydroxycyclohexyl]ethyl]amino]octanamide |
|---|---|
| PubChem CID | 172581109 |
| Molecular Formula | C64H127N3O3 |
| Molecular Weight | 986.74 g/mol |
| Exact Mass | 985.99 |
| IUPAC Name | N,N-didecyl-8-[[8-(didecylamino)-8-oxooctyl]-[2-[(1S,2R)-2-hydroxycyclohexyl]ethyl]amino]octanamide |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)C(=O)CCCCCCCN(CCCCCCCC(=O)N(CCCCCCCCCC)CCCCCCCCCC)CC[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C64H127N3O3/c1-5-9-13-17-21-25-35-45-56-66(57-46-36-26-22-18-14-10-6-2)63(69)51-39-31-29-33-43-54-65(60-53-61-49-41-42-50-62(61)68)55-44-34-30-32-40-52-64(70)67(58-47-37-27-23-19-15-11-7-3)59-48-38-28-24-20-16-12-8-4/h61-62,68H,5-60H2,1-4H3/t61-,62+/m0/s1 |
| InChIKey | CJKMFMAMMSAVKI-GFDBJVIDSA-N |
| XLogP | 19.13 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.74 |
| LogP ≤ 5 | 19.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|